C11H13F3N2O2S — CID 63922973
N-(1,1-dioxothian-3-yl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 63922973) has the molecular formula C11H13F3N2O2S and a molecular weight of 294.30 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(1,1-dioxothian-3-yl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63922973 |
| Molecular Formula | C11H13F3N2O2S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | O=S1(=O)CCCC(Nc2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C11H13F3N2O2S/c12-11(13,14)9-4-1-5-15-10(9)16-8-3-2-6-19(17,18)7-8/h1,4-5,8H,2-3,6-7H2,(H,15,16) |
| InChIKey | ZVYZYXKMHHIFOU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |