C14H21F3IN5O2S — CID 111141966
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111141966) has the molecular formula C14H21F3IN5O2S and a molecular weight of 507.32 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141966 |
| Molecular Formula | C14H21F3IN5O2S |
| Molecular Weight | 507.32 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNc1ncccc1C(F)(F)F)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C14H20F3N5O2S.HI/c1-18-13(22-10-4-8-25(23,24)9-10)21-7-6-20-12-11(14(15,16)17)3-2-5-19-12;/h2-3,5,10H,4,6-9H2,1H3,(H,19,20)(H2,18,21,22);1H |
| InChIKey | VNNVOWZZAYJDPU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|