C19H29F3N6 — CID 111918625
1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine (PubChem CID 111918625) has the molecular formula C19H29F3N6 and a molecular weight of 398.48 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111918625 |
| Molecular Formula | C19H29F3N6 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
| SMILES | C/N=C(\NCCNc1ncccc1C(F)(F)F)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C19H29F3N6/c1-23-18(27-14-8-12-28(13-14)15-5-2-3-6-15)26-11-10-25-17-16(19(20,21)22)7-4-9-24-17/h4,7,9,14-15H,2-3,5-6,8,10-13H2,1H3,(H,24,25)(H2,23,26,27) |
| InChIKey | VSYMNVGYBXGXAO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|