C14H22IN5O4S — CID 111141648
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide (PubChem CID 111141648) has the molecular formula C14H22IN5O4S and a molecular weight of 483.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141648 |
| Molecular Formula | C14H22IN5O4S |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNc1ccc([N+](=O)[O-])cc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C14H21N5O4S.HI/c1-15-14(18-12-6-9-24(22,23)10-12)17-8-7-16-11-2-4-13(5-3-11)19(20)21;/h2-5,12,16H,6-10H2,1H3,(H2,15,17,18);1H |
| InChIKey | RGXFTRCURSQEJB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|