C16H25IN4O4S2 — CID 111766716
1-(1,1-dioxothiolan-3-yl)-3-(3-methylsulfanylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111766716) has the molecular formula C16H25IN4O4S2 and a molecular weight of 528.44 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(3-methylsulfanylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(3-methylsulfanylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111766716 |
| Molecular Formula | C16H25IN4O4S2 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(3-methylsulfanylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CSCCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H24N4O4S2.HI/c1-25-9-2-8-17-16(19-14-7-10-26(23,24)12-14)18-11-13-3-5-15(6-4-13)20(21)22;/h3-6,14H,2,7-12H2,1H3,(H2,17,18,19);1H |
| InChIKey | XMWQKCHSRBPJAU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|