C20H34IN5O2S — CID 111763730
1-(3-methylsulfanylpropyl)-2-[(4-nitrophenyl)methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111763730) has the molecular formula C20H34IN5O2S and a molecular weight of 535.50 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-2-[(4-nitrophenyl)methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 1-(3-methylsulfanylpropyl)-2-[(4-nitrophenyl)methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111763730 |
| Molecular Formula | C20H34IN5O2S |
| Molecular Weight | 535.50 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-2-[(4-nitrophenyl)methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/Cc2ccc([N+](=O)[O-])cc2)NCCCSC)CC1.I |
| InChI | InChI=1S/C20H33N5O2S.HI/c1-3-12-24-13-9-18(10-14-24)23-20(21-11-4-15-28-2)22-16-17-5-7-19(8-6-17)25(26)27;/h5-8,18H,3-4,9-16H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | PGPINSBIDCUFFE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|