C22H26N4O4S — CID 111893735
1-(1,1-dioxothiolan-3-yl)-2-[(4-nitrophenyl)methyl]-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine (PubChem CID 111893735) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-[(4-nitrophenyl)methyl]-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-[(4-nitrophenyl)methyl]-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine |
|---|---|
| PubChem CID | 111893735 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-[(4-nitrophenyl)methyl]-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine |
| SMILES | O=[N+]([O-])c1ccc(C/N=C(/NC2CCc3ccccc3C2)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C22H26N4O4S/c27-26(28)21-9-5-16(6-10-21)14-23-22(25-20-11-12-31(29,30)15-20)24-19-8-7-17-3-1-2-4-18(17)13-19/h1-6,9-10,19-20H,7-8,11-15H2,(H2,23,24,25) |
| InChIKey | NYYIXNWSEHKKRA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|