C20H32N4O4S — CID 111143146
1-(1,1-dioxothiolan-3-yl)-3-(2-ethylhexyl)-2-[(4-nitrophenyl)methyl]guanidine (PubChem CID 111143146) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(2-ethylhexyl)-2-[(4-nitrophenyl)methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(2-ethylhexyl)-2-[(4-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111143146 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(2-ethylhexyl)-2-[(4-nitrophenyl)methyl]guanidine |
| SMILES | CCCCC(CC)CN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H32N4O4S/c1-3-5-6-16(4-2)13-21-20(23-18-11-12-29(27,28)15-18)22-14-17-7-9-19(10-8-17)24(25)26/h7-10,16,18H,3-6,11-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | NLOVQNHBUNCQBE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|