C13H16F3NO2S — CID 63924016
N-[4-methyl-3-(trifluoromethyl)phenyl]-1,1-dioxothian-3-amine (PubChem CID 63924016) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is N-[4-methyl-3-(trifluoromethyl)phenyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[4-methyl-3-(trifluoromethyl)phenyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63924016 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-[4-methyl-3-(trifluoromethyl)phenyl]-1,1-dioxothian-3-amine |
| SMILES | Cc1ccc(NC2CCCS(=O)(=O)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO2S/c1-9-4-5-10(7-12(9)13(14,15)16)17-11-3-2-6-20(18,19)8-11/h4-5,7,11,17H,2-3,6,8H2,1H3 |
| InChIKey | BRYHDAAWECHJIZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |