C9H8N4O3 — CID 71521221
[5-(3-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]urea (PubChem CID 71521221) has the molecular formula C9H8N4O3 and a molecular weight of 220.19 g/mol. Its IUPAC name is [5-(3-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]urea.
| Compound Name | [5-(3-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]urea |
|---|---|
| PubChem CID | 71521221 |
| Molecular Formula | C9H8N4O3 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | [5-(3-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]urea |
| SMILES | NC(=O)Nc1nnc(-c2cccc(O)c2)o1 |
| InChI | InChI=1S/C9H8N4O3/c10-8(15)11-9-13-12-7(16-9)5-2-1-3-6(14)4-5/h1-4,14H,(H3,10,11,13,15) |
| InChIKey | VIIFWIKXSBUTSN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |