methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate

C10H8N2O4 — CID 112685435

IUPACmethyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate
SMILESCOC(=O)c1nnc(-c2cccc(O)c2)o1
InChIInChI=1S/C10H8N2O4/c1-15-10(14)9-12-11-8(16-9)6-3-2-4-7(13)5-6/h2-5,13H,1H3
InChIKeyBAHZNSGVOYXMQP-UHFFFAOYSA-N
MW220.18 g/mol
LogP1.23
Rot. Bonds2

About methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate

methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 112685435) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate
PubChem CID112685435
Molecular FormulaC10H8N2O4
Molecular Weight220.18 g/mol
Exact Mass220.05
IUPAC Namemethyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate
SMILESCOC(=O)c1nnc(-c2cccc(O)c2)o1
InChIInChI=1S/C10H8N2O4/c1-15-10(14)9-12-11-8(16-9)6-3-2-4-7(13)5-6/h2-5,13H,1H3
InChIKeyBAHZNSGVOYXMQP-UHFFFAOYSA-N
XLogP1.23
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.18
LogP ≤ 51.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate (CID 112685435) is methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate is COC(=O)c1nnc(-c2cccc(O)c2)o1.
What is the InChIKey of methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is BAHZNSGVOYXMQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4/c1-15-10(14)9-12-11-8(16-9)6-3-2-4-7(13)5-6/h2-5,13H,1H3.
What are the key properties of methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate?
methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 220.18 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(3-hydroxyphenyl)-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 112685435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).