methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate

C10H6BrClN2O3 — CID 104538271

IUPACmethyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate
SMILESCOC(=O)c1nnc(-c2ccc(Cl)c(Br)c2)o1
InChIInChI=1S/C10H6BrClN2O3/c1-16-10(15)9-14-13-8(17-9)5-2-3-7(12)6(11)4-5/h2-4H,1H3
InChIKeyVVWRYCJSCPELPZ-UHFFFAOYSA-N
MW317.53 g/mol
LogP2.94
Rot. Bonds2

About methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate

methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 104538271) has the molecular formula C10H6BrClN2O3 and a molecular weight of 317.53 g/mol. Its IUPAC name is methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate
PubChem CID104538271
Molecular FormulaC10H6BrClN2O3
Molecular Weight317.53 g/mol
Exact Mass315.93
IUPAC Namemethyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate
SMILESCOC(=O)c1nnc(-c2ccc(Cl)c(Br)c2)o1
InChIInChI=1S/C10H6BrClN2O3/c1-16-10(15)9-14-13-8(17-9)5-2-3-7(12)6(11)4-5/h2-4H,1H3
InChIKeyVVWRYCJSCPELPZ-UHFFFAOYSA-N
XLogP2.94
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.53
LogP ≤ 52.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate (CID 104538271) is methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate is COC(=O)c1nnc(-c2ccc(Cl)c(Br)c2)o1.
What is the InChIKey of methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is VVWRYCJSCPELPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrClN2O3/c1-16-10(15)9-14-13-8(17-9)5-2-3-7(12)6(11)4-5/h2-4H,1H3.
What are the key properties of methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate?
methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 317.53 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(3-bromo-4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 104538271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).