C13H14N2O4 — CID 112618867
methyl 5-(3-propoxyphenyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 112618867) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is methyl 5-(3-propoxyphenyl)-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | methyl 5-(3-propoxyphenyl)-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 112618867 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 5-(3-propoxyphenyl)-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCCOc1cccc(-c2nnc(C(=O)OC)o2)c1 |
| InChI | InChI=1S/C13H14N2O4/c1-3-7-18-10-6-4-5-9(8-10)11-14-15-12(19-11)13(16)17-2/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | KUZUBKVVWNAXJL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |