C19H16ClN3O4 — CID 9031554
2-[(Z)-1-chloro-2-(4-propoxyphenyl)ethenyl]-5-(3-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 9031554) has the molecular formula C19H16ClN3O4 and a molecular weight of 385.81 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(4-propoxyphenyl)ethenyl]-5-(3-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(Z)-1-chloro-2-(4-propoxyphenyl)ethenyl]-5-(3-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 9031554 |
| Molecular Formula | C19H16ClN3O4 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(4-propoxyphenyl)ethenyl]-5-(3-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | CCCOc1ccc(/C=C(\Cl)c2nnc(-c3cccc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C19H16ClN3O4/c1-2-10-26-16-8-6-13(7-9-16)11-17(20)19-22-21-18(27-19)14-4-3-5-15(12-14)23(24)25/h3-9,11-12H,2,10H2,1H3/b17-11- |
| InChIKey | MDRSTIAGVGVDBV-BOPFTXTBSA-N |
| XLogP | 5.17 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|