C18H14ClN3O5 — CID 9031909
2-[(Z)-1-chloro-2-(3,5-dimethoxyphenyl)ethenyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 9031909) has the molecular formula C18H14ClN3O5 and a molecular weight of 387.78 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(3,5-dimethoxyphenyl)ethenyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(Z)-1-chloro-2-(3,5-dimethoxyphenyl)ethenyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 9031909 |
| Molecular Formula | C18H14ClN3O5 |
| Molecular Weight | 387.78 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(3,5-dimethoxyphenyl)ethenyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | COc1cc(/C=C(\Cl)c2nnc(-c3ccc([N+](=O)[O-])cc3)o2)cc(OC)c1 |
| InChI | InChI=1S/C18H14ClN3O5/c1-25-14-7-11(8-15(10-14)26-2)9-16(19)18-21-20-17(27-18)12-3-5-13(6-4-12)22(23)24/h3-10H,1-2H3/b16-9- |
| InChIKey | CATSHEMXDACCEL-SXGWCWSVSA-N |
| XLogP | 4.40 |
| TPSA | 100.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.78 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|