C13H13N3O5 — CID 2739028
butyl 5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 2739028) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is butyl 5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | butyl 5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 2739028 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | butyl 5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCCCOC(=O)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C13H13N3O5/c1-2-3-8-20-13(17)12-15-14-11(21-12)9-4-6-10(7-5-9)16(18)19/h4-7H,2-3,8H2,1H3 |
| InChIKey | ZHLQREBWNKAVNC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|