C9H7N5O4 — CID 136799712
N'-hydroxy-5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboximidamide (PubChem CID 136799712) has the molecular formula C9H7N5O4 and a molecular weight of 249.19 g/mol. Its IUPAC name is N'-hydroxy-5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboximidamide.
| Compound Name | N'-hydroxy-5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboximidamide |
|---|---|
| PubChem CID | 136799712 |
| Molecular Formula | C9H7N5O4 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | N'-hydroxy-5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboximidamide |
| SMILES | N/C(=N/O)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C9H7N5O4/c10-7(13-15)9-12-11-8(18-9)5-1-3-6(4-2-5)14(16)17/h1-4,15H,(H2,10,13) |
| InChIKey | FEGKHGSXYTVOLO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|