C8H5N3O3S — CID 175716883
2-deuteriosulfanyl-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 175716883) has the molecular formula C8H5N3O3S and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-deuteriosulfanyl-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-deuteriosulfanyl-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 175716883 |
| Molecular Formula | C8H5N3O3S |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2-deuteriosulfanyl-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | [2H]Sc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C8H5N3O3S/c12-11(13)6-3-1-5(2-4-6)7-9-10-8(15)14-7/h1-4H,(H,10,15)/i/hD |
| InChIKey | ABSVCMBOXHMZPV-DYCDLGHISA-N |
| XLogP | 1.93 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|