C12H15N3O2 — CID 91675556
5-(3-butoxyphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 91675556) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-(3-butoxyphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(3-butoxyphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 91675556 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 5-(3-butoxyphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCCOc1cccc(-c2nnc(N)o2)c1 |
| InChI | InChI=1S/C12H15N3O2/c1-2-3-7-16-10-6-4-5-9(8-10)11-14-15-12(13)17-11/h4-6,8H,2-3,7H2,1H3,(H2,13,15) |
| InChIKey | AAAHJGDQBGTHHV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|