C19H20N2O2 — CID 56697618
2-(4-butoxyphenyl)-5-(3-methylphenyl)-1,3,4-oxadiazole (PubChem CID 56697618) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-5-(3-methylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(4-butoxyphenyl)-5-(3-methylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 56697618 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(4-butoxyphenyl)-5-(3-methylphenyl)-1,3,4-oxadiazole |
| SMILES | CCCCOc1ccc(-c2nnc(-c3cccc(C)c3)o2)cc1 |
| InChI | InChI=1S/C19H20N2O2/c1-3-4-12-22-17-10-8-15(9-11-17)18-20-21-19(23-18)16-7-5-6-14(2)13-16/h5-11,13H,3-4,12H2,1-2H3 |
| InChIKey | LFVWMIVQJHGXLC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|