C33H34N4O3 — CID 58468621
2-[3-ethenyl-4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-5-(4-octoxyphenyl)-1,3,4-oxadiazole (PubChem CID 58468621) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-[3-ethenyl-4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-5-(4-octoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[3-ethenyl-4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-5-(4-octoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 58468621 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 2-[3-ethenyl-4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-5-(4-octoxyphenyl)-1,3,4-oxadiazole |
| SMILES | C=Cc1cc(-c2nnc(-c3ccc(OCCCCCCCC)cc3)o2)ccc1-c1nnc(-c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C33H34N4O3/c1-4-6-7-8-9-10-21-38-28-18-15-26(16-19-28)30-34-36-32(39-30)27-17-20-29(24(5-2)22-27)33-37-35-31(40-33)25-13-11-23(3)12-14-25/h5,11-20,22H,2,4,6-10,21H2,1,3H3 |
| InChIKey | PIGDUVLNUDVUFI-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|