C32H34N2O3 — CID 102212549
2-[4-[(E)-2-(2,5-dibutoxyphenyl)ethenyl]phenyl]-5-(4-ethenylphenyl)-1,3,4-oxadiazole (PubChem CID 102212549) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-[4-[(E)-2-(2,5-dibutoxyphenyl)ethenyl]phenyl]-5-(4-ethenylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-[(E)-2-(2,5-dibutoxyphenyl)ethenyl]phenyl]-5-(4-ethenylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 102212549 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 2-[4-[(E)-2-(2,5-dibutoxyphenyl)ethenyl]phenyl]-5-(4-ethenylphenyl)-1,3,4-oxadiazole |
| SMILES | C=Cc1ccc(-c2nnc(-c3ccc(/C=C/c4cc(OCCCC)ccc4OCCCC)cc3)o2)cc1 |
| InChI | InChI=1S/C32H34N2O3/c1-4-7-21-35-29-19-20-30(36-22-8-5-2)28(23-29)18-13-25-11-16-27(17-12-25)32-34-33-31(37-32)26-14-9-24(6-3)10-15-26/h6,9-20,23H,3-5,7-8,21-22H2,1-2H3/b18-13+ |
| InChIKey | ORDQPPFERQBLRZ-QGOAFFKASA-N |
| XLogP | 8.57 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|