C31H31F3N2O3 — CID 132601184
2-[4-[(E)-2-(3,4-dibutoxyphenyl)ethenyl]phenyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole (PubChem CID 132601184) has the molecular formula C31H31F3N2O3 and a molecular weight of 536.59 g/mol. Its IUPAC name is 2-[4-[(E)-2-(3,4-dibutoxyphenyl)ethenyl]phenyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[4-[(E)-2-(3,4-dibutoxyphenyl)ethenyl]phenyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 132601184 |
| Molecular Formula | C31H31F3N2O3 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 2-[4-[(E)-2-(3,4-dibutoxyphenyl)ethenyl]phenyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
| SMILES | CCCCOc1ccc(/C=C/c2ccc(-c3nnc(-c4ccc(C(F)(F)F)cc4)o3)cc2)cc1OCCCC |
| InChI | InChI=1S/C31H31F3N2O3/c1-3-5-19-37-27-18-11-23(21-28(27)38-20-6-4-2)8-7-22-9-12-24(13-10-22)29-35-36-30(39-29)25-14-16-26(17-15-25)31(32,33)34/h7-18,21H,3-6,19-20H2,1-2H3/b8-7+ |
| InChIKey | MBLDSZGPXGPBKT-BQYQJAHWSA-N |
| XLogP | 8.95 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|