C20H16F3NO4 — CID 141069615
3-methoxy-4-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde (PubChem CID 141069615) has the molecular formula C20H16F3NO4 and a molecular weight of 391.35 g/mol. Its IUPAC name is 3-methoxy-4-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde.
| Compound Name | 3-methoxy-4-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 141069615 |
| Molecular Formula | C20H16F3NO4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 3-methoxy-4-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]benzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCc1nc(-c2ccc(C(F)(F)F)cc2)oc1C |
| InChI | InChI=1S/C20H16F3NO4/c1-12-16(11-27-17-8-3-13(10-25)9-18(17)26-2)24-19(28-12)14-4-6-15(7-5-14)20(21,22)23/h3-10H,11H2,1-2H3 |
| InChIKey | PXIAJHWDBAXKED-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|