C21H14F3NO3 — CID 10667776
2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl]-1-benzofuran-5-carbaldehyde (PubChem CID 10667776) has the molecular formula C21H14F3NO3 and a molecular weight of 385.34 g/mol. Its IUPAC name is 2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl]-1-benzofuran-5-carbaldehyde.
| Compound Name | 2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl]-1-benzofuran-5-carbaldehyde |
|---|---|
| PubChem CID | 10667776 |
| Molecular Formula | C21H14F3NO3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl]-1-benzofuran-5-carbaldehyde |
| SMILES | Cc1oc(-c2ccc(C(F)(F)F)cc2)nc1Cc1cc2cc(C=O)ccc2o1 |
| InChI | InChI=1S/C21H14F3NO3/c1-12-18(10-17-9-15-8-13(11-26)2-7-19(15)28-17)25-20(27-12)14-3-5-16(6-4-14)21(22,23)24/h2-9,11H,10H2,1H3 |
| InChIKey | NOGFKWYZFREUAL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|