C24H18F6N2O3 — CID 21082219
4-[4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-5-methyl-1,3-oxazol-2-yl]benzaldehyde (PubChem CID 21082219) has the molecular formula C24H18F6N2O3 and a molecular weight of 496.41 g/mol. Its IUPAC name is 4-[4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-5-methyl-1,3-oxazol-2-yl]benzaldehyde.
| Compound Name | 4-[4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-5-methyl-1,3-oxazol-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 21082219 |
| Molecular Formula | C24H18F6N2O3 |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 4-[4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-5-methyl-1,3-oxazol-2-yl]benzaldehyde |
| SMILES | Cc1oc(-c2ccc(C=O)cc2)nc1Cn1c(C)cc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C24H18F6N2O3/c1-13-9-17-10-18(22(34,23(25,26)27)24(28,29)30)7-8-20(17)32(13)11-19-14(2)35-21(31-19)16-5-3-15(12-33)4-6-16/h3-10,12,34H,11H2,1-2H3 |
| InChIKey | NWSOZRNYAOGKOV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|