C22H18F7NO3 — CID 11719878
1,1,1,3,3,3-hexafluoro-2-[4-[[2-(4-fluoro-3-methylphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methylphenyl]propan-2-ol (PubChem CID 11719878) has the molecular formula C22H18F7NO3 and a molecular weight of 477.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[[2-(4-fluoro-3-methylphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methylphenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[[2-(4-fluoro-3-methylphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methylphenyl]propan-2-ol |
|---|---|
| PubChem CID | 11719878 |
| Molecular Formula | C22H18F7NO3 |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[[2-(4-fluoro-3-methylphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methylphenyl]propan-2-ol |
| SMILES | Cc1cc(-c2nc(COc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3C)c(C)o2)ccc1F |
| InChI | InChI=1S/C22H18F7NO3/c1-11-8-14(4-6-16(11)23)19-30-17(13(3)33-19)10-32-18-7-5-15(9-12(18)2)20(31,21(24,25)26)22(27,28)29/h4-9,31H,10H2,1-3H3 |
| InChIKey | BVJIYQPTFKNFKT-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |