C20H13Cl2F6NO3 — CID 11691818
2-[3-chloro-4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11691818) has the molecular formula C20H13Cl2F6NO3 and a molecular weight of 500.22 g/mol. Its IUPAC name is 2-[3-chloro-4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-chloro-4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11691818 |
| Molecular Formula | C20H13Cl2F6NO3 |
| Molecular Weight | 500.22 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 2-[3-chloro-4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1oc(-c2cccc(Cl)c2)nc1COc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H13Cl2F6NO3/c1-10-15(29-17(32-10)11-3-2-4-13(21)7-11)9-31-16-6-5-12(8-14(16)22)18(30,19(23,24)25)20(26,27)28/h2-8,30H,9H2,1H3 |
| InChIKey | BMLLVVJCONJPSA-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.22 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |