C20H14ClF6NO3 — CID 11641273
2-[4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11641273) has the molecular formula C20H14ClF6NO3 and a molecular weight of 465.78 g/mol. Its IUPAC name is 2-[4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11641273 |
| Molecular Formula | C20H14ClF6NO3 |
| Molecular Weight | 465.78 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 2-[4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1oc(-c2cccc(Cl)c2)nc1COc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H14ClF6NO3/c1-11-16(28-17(31-11)12-3-2-4-14(21)9-12)10-30-15-7-5-13(6-8-15)18(29,19(22,23)24)20(25,26)27/h2-9,29H,10H2,1H3 |
| InChIKey | AWYPVZSFSKTMIS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.78 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |