C12H11F2NO2 — CID 82220028
2-[2-(3,4-difluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethanol (PubChem CID 82220028) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethanol.
| Compound Name | 2-[2-(3,4-difluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethanol |
|---|---|
| PubChem CID | 82220028 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethanol |
| SMILES | Cc1oc(-c2ccc(F)c(F)c2)nc1CCO |
| InChI | InChI=1S/C12H11F2NO2/c1-7-11(4-5-16)15-12(17-7)8-2-3-9(13)10(14)6-8/h2-3,6,16H,4-5H2,1H3 |
| InChIKey | MOKHBTOEGCNQCV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |