C13H14FNO2 — CID 18376373
2-[5-ethyl-2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanol (PubChem CID 18376373) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 2-[5-ethyl-2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanol.
| Compound Name | 2-[5-ethyl-2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanol |
|---|---|
| PubChem CID | 18376373 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[5-ethyl-2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethanol |
| SMILES | CCc1oc(-c2ccc(F)cc2)nc1CCO |
| InChI | InChI=1S/C13H14FNO2/c1-2-12-11(7-8-16)15-13(17-12)9-3-5-10(14)6-4-9/h3-6,16H,2,7-8H2,1H3 |
| InChIKey | BANDAEIKEKUCLJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |