3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid

C13H12FNO3 — CID 82131267

IUPAC3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid
SMILESCc1oc(-c2ccc(F)cc2)nc1CCC(=O)O
InChIInChI=1S/C13H12FNO3/c1-8-11(6-7-12(16)17)15-13(18-8)9-2-4-10(14)5-3-9/h2-5H,6-7H2,1H3,(H,16,17)
InChIKeySMGNEGMKHAHZRE-UHFFFAOYSA-N
MW249.24 g/mol
LogP2.81
Rot. Bonds4

About 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid

3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid (PubChem CID 82131267) has the molecular formula C13H12FNO3 and a molecular weight of 249.24 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid
PubChem CID82131267
Molecular FormulaC13H12FNO3
Molecular Weight249.24 g/mol
Exact Mass249.08
IUPAC Name3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid
SMILESCc1oc(-c2ccc(F)cc2)nc1CCC(=O)O
InChIInChI=1S/C13H12FNO3/c1-8-11(6-7-12(16)17)15-13(18-8)9-2-4-10(14)5-3-9/h2-5H,6-7H2,1H3,(H,16,17)
InChIKeySMGNEGMKHAHZRE-UHFFFAOYSA-N
XLogP2.81
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.24
LogP ≤ 52.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid?
The IUPAC name of 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid (CID 82131267) is 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid?
The canonical SMILES for 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid is Cc1oc(-c2ccc(F)cc2)nc1CCC(=O)O.
What is the InChIKey of 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid?
The InChIKey is SMGNEGMKHAHZRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO3/c1-8-11(6-7-12(16)17)15-13(18-8)9-2-4-10(14)5-3-9/h2-5H,6-7H2,1H3,(H,16,17).
What are the key properties of 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid?
3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid has a molecular weight of 249.24 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 82131267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).