3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid

C11H11NO4 — CID 82127717

IUPAC3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid
SMILESCc1oc(-c2ccco2)nc1CCC(=O)O
InChIInChI=1S/C11H11NO4/c1-7-8(4-5-10(13)14)12-11(16-7)9-3-2-6-15-9/h2-3,6H,4-5H2,1H3,(H,13,14)
InChIKeyLYZHVQWWLLACSO-UHFFFAOYSA-N
MW221.21 g/mol
LogP2.26
Rot. Bonds4

About 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid

3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid (PubChem CID 82127717) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid
PubChem CID82127717
Molecular FormulaC11H11NO4
Molecular Weight221.21 g/mol
Exact Mass221.07
IUPAC Name3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid
SMILESCc1oc(-c2ccco2)nc1CCC(=O)O
InChIInChI=1S/C11H11NO4/c1-7-8(4-5-10(13)14)12-11(16-7)9-3-2-6-15-9/h2-3,6H,4-5H2,1H3,(H,13,14)
InChIKeyLYZHVQWWLLACSO-UHFFFAOYSA-N
XLogP2.26
TPSA76.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.21
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid?
The IUPAC name of 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid (CID 82127717) is 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid?
The canonical SMILES for 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid is Cc1oc(-c2ccco2)nc1CCC(=O)O.
What is the InChIKey of 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid?
The InChIKey is LYZHVQWWLLACSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-7-8(4-5-10(13)14)12-11(16-7)9-3-2-6-15-9/h2-3,6H,4-5H2,1H3,(H,13,14).
What are the key properties of 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid?
3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid has a molecular weight of 221.21 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 82127717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).