C11H11NO4 — CID 82127717
3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid (PubChem CID 82127717) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 82127717 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]propanoic acid |
| SMILES | Cc1oc(-c2ccco2)nc1CCC(=O)O |
| InChI | InChI=1S/C11H11NO4/c1-7-8(4-5-10(13)14)12-11(16-7)9-3-2-6-15-9/h2-3,6H,4-5H2,1H3,(H,13,14) |
| InChIKey | LYZHVQWWLLACSO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |