C12H12N2O4 — CID 25147932
2-[5-methyl-2-(3-nitrophenyl)-1,3-oxazol-4-yl]ethanol (PubChem CID 25147932) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 2-[5-methyl-2-(3-nitrophenyl)-1,3-oxazol-4-yl]ethanol.
| Compound Name | 2-[5-methyl-2-(3-nitrophenyl)-1,3-oxazol-4-yl]ethanol |
|---|---|
| PubChem CID | 25147932 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-[5-methyl-2-(3-nitrophenyl)-1,3-oxazol-4-yl]ethanol |
| SMILES | Cc1oc(-c2cccc([N+](=O)[O-])c2)nc1CCO |
| InChI | InChI=1S/C12H12N2O4/c1-8-11(5-6-15)13-12(18-8)9-3-2-4-10(7-9)14(16)17/h2-4,7,15H,5-6H2,1H3 |
| InChIKey | WQZWEXGIEVDXME-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|