C13H12N2O5 — CID 43133305
3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid (PubChem CID 43133305) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid.
| Compound Name | 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 43133305 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid |
| SMILES | Cc1nc(CCC(=O)O)oc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N2O5/c1-8-13(20-11(14-8)5-6-12(16)17)9-3-2-4-10(7-9)15(18)19/h2-4,7H,5-6H2,1H3,(H,16,17) |
| InChIKey | MYXKXOWSVVACGC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|