3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid

C13H12N2O5 — CID 43133305

IUPAC3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid
SMILESCc1nc(CCC(=O)O)oc1-c1cccc([N+](=O)[O-])c1
InChIInChI=1S/C13H12N2O5/c1-8-13(20-11(14-8)5-6-12(16)17)9-3-2-4-10(7-9)15(18)19/h2-4,7H,5-6H2,1H3,(H,16,17)
InChIKeyMYXKXOWSVVACGC-UHFFFAOYSA-N
MW276.25 g/mol
LogP2.58
Rot. Bonds5

About 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid

3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid (PubChem CID 43133305) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid.

Molecular Properties

Compound Name3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid
PubChem CID43133305
Molecular FormulaC13H12N2O5
Molecular Weight276.25 g/mol
Exact Mass276.07
IUPAC Name3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid
SMILESCc1nc(CCC(=O)O)oc1-c1cccc([N+](=O)[O-])c1
InChIInChI=1S/C13H12N2O5/c1-8-13(20-11(14-8)5-6-12(16)17)9-3-2-4-10(7-9)15(18)19/h2-4,7H,5-6H2,1H3,(H,16,17)
InChIKeyMYXKXOWSVVACGC-UHFFFAOYSA-N
XLogP2.58
TPSA106.47 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.25
LogP ≤ 52.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid?
The IUPAC name of 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid (CID 43133305) is 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid.
What is the SMILES notation for 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid?
The canonical SMILES for 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid is Cc1nc(CCC(=O)O)oc1-c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid?
The InChIKey is MYXKXOWSVVACGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O5/c1-8-13(20-11(14-8)5-6-12(16)17)9-3-2-4-10(7-9)15(18)19/h2-4,7H,5-6H2,1H3,(H,16,17).
What are the key properties of 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid?
3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid has a molecular weight of 276.25 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-methyl-5-(3-nitrophenyl)-1,3-oxazol-2-yl]propanoic acid is sourced from PubChem (CID 43133305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).