C19H18N2O6 — CID 23076542
[3-methoxy-4-[[5-methyl-2-(3-nitrophenyl)-1,3-oxazol-4-yl]methoxy]phenyl]methanol (PubChem CID 23076542) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is [3-methoxy-4-[[5-methyl-2-(3-nitrophenyl)-1,3-oxazol-4-yl]methoxy]phenyl]methanol.
| Compound Name | [3-methoxy-4-[[5-methyl-2-(3-nitrophenyl)-1,3-oxazol-4-yl]methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 23076542 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [3-methoxy-4-[[5-methyl-2-(3-nitrophenyl)-1,3-oxazol-4-yl]methoxy]phenyl]methanol |
| SMILES | COc1cc(CO)ccc1OCc1nc(-c2cccc([N+](=O)[O-])c2)oc1C |
| InChI | InChI=1S/C19H18N2O6/c1-12-16(11-26-17-7-6-13(10-22)8-18(17)25-2)20-19(27-12)14-4-3-5-15(9-14)21(23)24/h3-9,22H,10-11H2,1-2H3 |
| InChIKey | YKZCJGICOHVNOW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|