C12H7N3O3 — CID 59680369
2-(3-nitrophenyl)-[1,3]oxazolo[5,4-c]pyridine (PubChem CID 59680369) has the molecular formula C12H7N3O3 and a molecular weight of 241.21 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-[1,3]oxazolo[5,4-c]pyridine.
| Compound Name | 2-(3-nitrophenyl)-[1,3]oxazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 59680369 |
| Molecular Formula | C12H7N3O3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-(3-nitrophenyl)-[1,3]oxazolo[5,4-c]pyridine |
| SMILES | O=[N+]([O-])c1cccc(-c2nc3ccncc3o2)c1 |
| InChI | InChI=1S/C12H7N3O3/c16-15(17)9-3-1-2-8(6-9)12-14-10-4-5-13-7-11(10)18-12/h1-7H |
| InChIKey | FSPKALSPPQINMC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|