C15H10N2O4 — CID 728392
8-methyl-2-(3-nitrophenyl)-3,1-benzoxazin-4-one (PubChem CID 728392) has the molecular formula C15H10N2O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 8-methyl-2-(3-nitrophenyl)-3,1-benzoxazin-4-one.
| Compound Name | 8-methyl-2-(3-nitrophenyl)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 728392 |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 8-methyl-2-(3-nitrophenyl)-3,1-benzoxazin-4-one |
| SMILES | Cc1cccc2c(=O)oc(-c3cccc([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C15H10N2O4/c1-9-4-2-7-12-13(9)16-14(21-15(12)18)10-5-3-6-11(8-10)17(19)20/h2-8H,1H3 |
| InChIKey | XXNMMBXJUQVVOM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|