C12H11BrINO — CID 58951394
2-(4-bromophenyl)-4-(2-iodoethyl)-5-methyl-1,3-oxazole (PubChem CID 58951394) has the molecular formula C12H11BrINO and a molecular weight of 392.03 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-(2-iodoethyl)-5-methyl-1,3-oxazole.
| Compound Name | 2-(4-bromophenyl)-4-(2-iodoethyl)-5-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 58951394 |
| Molecular Formula | C12H11BrINO |
| Molecular Weight | 392.03 g/mol |
| Exact Mass | 390.91 |
| IUPAC Name | 2-(4-bromophenyl)-4-(2-iodoethyl)-5-methyl-1,3-oxazole |
| SMILES | Cc1oc(-c2ccc(Br)cc2)nc1CCI |
| InChI | InChI=1S/C12H11BrINO/c1-8-11(6-7-14)15-12(16-8)9-2-4-10(13)5-3-9/h2-5H,6-7H2,1H3 |
| InChIKey | VQLVDQGWSNHYAZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.03 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|