C23H20F6N2O2 — CID 11496479
1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-2,3-dihydroindol-5-yl]propan-2-ol (PubChem CID 11496479) has the molecular formula C23H20F6N2O2 and a molecular weight of 470.41 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-2,3-dihydroindol-5-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-2,3-dihydroindol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 11496479 |
| Molecular Formula | C23H20F6N2O2 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-2,3-dihydroindol-5-yl]propan-2-ol |
| SMILES | Cc1oc(-c2ccccc2)nc1CN1c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2CC1C |
| InChI | InChI=1S/C23H20F6N2O2/c1-13-10-16-11-17(21(32,22(24,25)26)23(27,28)29)8-9-19(16)31(13)12-18-14(2)33-20(30-18)15-6-4-3-5-7-15/h3-9,11,13,32H,10,12H2,1-2H3 |
| InChIKey | FIRCHXGRTDLYPB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|