C27H27NO4 — CID 10836339
4-[[5-[2,2-bis(prop-2-enoxy)ethyl]-1-benzofuran-2-yl]methyl]-5-methyl-2-phenyl-1,3-oxazole (PubChem CID 10836339) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 4-[[5-[2,2-bis(prop-2-enoxy)ethyl]-1-benzofuran-2-yl]methyl]-5-methyl-2-phenyl-1,3-oxazole.
| Compound Name | 4-[[5-[2,2-bis(prop-2-enoxy)ethyl]-1-benzofuran-2-yl]methyl]-5-methyl-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 10836339 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 4-[[5-[2,2-bis(prop-2-enoxy)ethyl]-1-benzofuran-2-yl]methyl]-5-methyl-2-phenyl-1,3-oxazole |
| SMILES | C=CCOC(Cc1ccc2oc(Cc3nc(-c4ccccc4)oc3C)cc2c1)OCC=C |
| InChI | InChI=1S/C27H27NO4/c1-4-13-29-26(30-14-5-2)16-20-11-12-25-22(15-20)17-23(32-25)18-24-19(3)31-27(28-24)21-9-7-6-8-10-21/h4-12,15,17,26H,1-2,13-14,16,18H2,3H3 |
| InChIKey | SUQNDVKFXFPLTF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 57.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|