C25H25NO6 — CID 10836630
2-(3-hydroxypropoxy)-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]propanoic acid (PubChem CID 10836630) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-(3-hydroxypropoxy)-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]propanoic acid.
| Compound Name | 2-(3-hydroxypropoxy)-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]propanoic acid |
|---|---|
| PubChem CID | 10836630 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-(3-hydroxypropoxy)-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]propanoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1Cc1cc2cc(CC(OCCCO)C(=O)O)ccc2o1 |
| InChI | InChI=1S/C25H25NO6/c1-16-21(26-24(31-16)18-6-3-2-4-7-18)15-20-14-19-12-17(8-9-22(19)32-20)13-23(25(28)29)30-11-5-10-27/h2-4,6-9,12,14,23,27H,5,10-11,13,15H2,1H3,(H,28,29) |
| InChIKey | HCRUWLDZJBXNNG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|