C25H23NO4 — CID 67619983
ethyl (Z)-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]but-2-enoate (PubChem CID 67619983) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is ethyl (Z)-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]but-2-enoate.
| Compound Name | ethyl (Z)-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]but-2-enoate |
|---|---|
| PubChem CID | 67619983 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | ethyl (Z)-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/C)c1ccc2oc(Cc3nc(-c4ccccc4)oc3C)cc2c1 |
| InChI | InChI=1S/C25H23NO4/c1-4-28-24(27)12-16(2)19-10-11-23-20(13-19)14-21(30-23)15-22-17(3)29-25(26-22)18-8-6-5-7-9-18/h5-14H,4,15H2,1-3H3/b16-12- |
| InChIKey | VKSCBNKVATWWBU-VBKFSLOCSA-N |
| XLogP | 5.95 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|