C24H22BrNO4 — CID 10671958
ethyl 2-bromo-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]propanoate (PubChem CID 10671958) has the molecular formula C24H22BrNO4 and a molecular weight of 468.35 g/mol. Its IUPAC name is ethyl 2-bromo-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]propanoate.
| Compound Name | ethyl 2-bromo-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]propanoate |
|---|---|
| PubChem CID | 10671958 |
| Molecular Formula | C24H22BrNO4 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | ethyl 2-bromo-3-[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1-benzofuran-5-yl]propanoate |
| SMILES | CCOC(=O)C(Br)Cc1ccc2oc(Cc3nc(-c4ccccc4)oc3C)cc2c1 |
| InChI | InChI=1S/C24H22BrNO4/c1-3-28-24(27)20(25)12-16-9-10-22-18(11-16)13-19(30-22)14-21-15(2)29-23(26-21)17-7-5-4-6-8-17/h4-11,13,20H,3,12,14H2,1-2H3 |
| InChIKey | JMXVLWNUBFTHDB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|