C18H16N2O4 — CID 38833285
3-methoxy-4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]benzaldehyde (PubChem CID 38833285) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-methoxy-4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]benzaldehyde.
| Compound Name | 3-methoxy-4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 38833285 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-methoxy-4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]benzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCc1nnc(-c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C18H16N2O4/c1-12-3-6-14(7-4-12)18-20-19-17(24-18)11-23-15-8-5-13(10-21)9-16(15)22-2/h3-10H,11H2,1-2H3 |
| InChIKey | UHCVABBTHXYACG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|