C20H19NO6 — CID 12967874
4-[[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]methoxy]-3-methoxybenzaldehyde (PubChem CID 12967874) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 4-[[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]methoxy]-3-methoxybenzaldehyde.
| Compound Name | 4-[[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]methoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 12967874 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-[[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]methoxy]-3-methoxybenzaldehyde |
| SMILES | COc1ccc(-c2cc(COc3ccc(C=O)cc3OC)on2)cc1OC |
| InChI | InChI=1S/C20H19NO6/c1-23-17-7-5-14(9-20(17)25-3)16-10-15(27-21-16)12-26-18-6-4-13(11-22)8-19(18)24-2/h4-11H,12H2,1-3H3 |
| InChIKey | MUPHBTUTKHOPDS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|