C11H10N2O4 — CID 28782536
3-methoxy-4-(1,2,4-oxadiazol-3-ylmethoxy)benzaldehyde (PubChem CID 28782536) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-methoxy-4-(1,2,4-oxadiazol-3-ylmethoxy)benzaldehyde.
| Compound Name | 3-methoxy-4-(1,2,4-oxadiazol-3-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 28782536 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-methoxy-4-(1,2,4-oxadiazol-3-ylmethoxy)benzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCc1ncon1 |
| InChI | InChI=1S/C11H10N2O4/c1-15-10-4-8(5-14)2-3-9(10)16-6-11-12-7-17-13-11/h2-5,7H,6H2,1H3 |
| InChIKey | ACRFNUVLJSSYOZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|