C14H17N5O3 — CID 30834017
4-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methoxy]-3-methoxybenzaldehyde (PubChem CID 30834017) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methoxy]-3-methoxybenzaldehyde.
| Compound Name | 4-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 30834017 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methoxy]-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCc1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H17N5O3/c1-19(2)14-17-12(16-13(15)18-14)8-22-10-5-4-9(7-20)6-11(10)21-3/h4-7H,8H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | LIAQGJLRACZEJF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|