C15H17NO4 — CID 22727348
3-[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]butanal (PubChem CID 22727348) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]butanal.
| Compound Name | 3-[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]butanal |
|---|---|
| PubChem CID | 22727348 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-[3-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]butanal |
| SMILES | COc1ccc(-c2cc(C(C)CC=O)on2)cc1OC |
| InChI | InChI=1S/C15H17NO4/c1-10(6-7-17)14-9-12(16-20-14)11-4-5-13(18-2)15(8-11)19-3/h4-5,7-10H,6H2,1-3H3 |
| InChIKey | COUDYNUXUFASJU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|