C17H21NO4 — CID 118305351
1-[3-(3-cyclopentyloxy-4-methoxyphenyl)-1,2-oxazol-5-yl]ethanol (PubChem CID 118305351) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[3-(3-cyclopentyloxy-4-methoxyphenyl)-1,2-oxazol-5-yl]ethanol.
| Compound Name | 1-[3-(3-cyclopentyloxy-4-methoxyphenyl)-1,2-oxazol-5-yl]ethanol |
|---|---|
| PubChem CID | 118305351 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-[3-(3-cyclopentyloxy-4-methoxyphenyl)-1,2-oxazol-5-yl]ethanol |
| SMILES | COc1ccc(-c2cc(C(C)O)on2)cc1OC1CCCC1 |
| InChI | InChI=1S/C17H21NO4/c1-11(19)16-10-14(18-22-16)12-7-8-15(20-2)17(9-12)21-13-5-3-4-6-13/h7-11,13,19H,3-6H2,1-2H3 |
| InChIKey | SLRARAVOVHEMFX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |